C28H36O15Se — CID 11389037
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-phenylselanyloxan-4-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 11389037) has the molecular formula C28H36O15Se and a molecular weight of 691.54 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-phenylselanyloxan-4-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-phenylselanyloxan-4-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11389037 |
| Molecular Formula | C28H36O15Se |
| Molecular Weight | 691.54 g/mol |
| Exact Mass | 692.12 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(2R,3R,4S,5R,6S)-5-acetyloxy-3-hydroxy-2-(hydroxymethyl)-6-phenylselanyloxan-4-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@H]([Se]c3ccccc3)[C@@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H36O15Se/c1-13(30)36-12-20-22(37-14(2)31)24(38-15(3)32)25(39-16(4)33)27(41-20)43-23-21(35)19(11-29)42-28(26(23)40-17(5)34)44-18-9-7-6-8-10-18/h6-10,19-29,35H,11-12H2,1-5H3/t19-,20-,21-,22-,23+,24+,25-,26-,27+,28+/m1/s1 |
| InChIKey | DLDHIENWFBUZSB-AXXYRMHMSA-N |
| XLogP | -1.51 |
| TPSA | 199.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.54 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|