C25H29ClO9Se — CID 101154104
[(2S,3R,4R,5R,6S)-4,5-diacetyloxy-6-[[(1S,2S,4R,5S,6S)-5-chloro-3-oxo-6-phenylselanyl-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-2-methyloxan-3-yl] acetate (PubChem CID 101154104) has the molecular formula C25H29ClO9Se and a molecular weight of 587.91 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6S)-4,5-diacetyloxy-6-[[(1S,2S,4R,5S,6S)-5-chloro-3-oxo-6-phenylselanyl-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5R,6S)-4,5-diacetyloxy-6-[[(1S,2S,4R,5S,6S)-5-chloro-3-oxo-6-phenylselanyl-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101154104 |
| Molecular Formula | C25H29ClO9Se |
| Molecular Weight | 587.91 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | [(2S,3R,4R,5R,6S)-4,5-diacetyloxy-6-[[(1S,2S,4R,5S,6S)-5-chloro-3-oxo-6-phenylselanyl-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](C)O[C@@H](C[C@@H]2C(=O)[C@H]3O[C@@H]2[C@H]([Se]c2ccccc2)[C@H]3Cl)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H29ClO9Se/c1-11-20(32-12(2)27)24(34-14(4)29)22(33-13(3)28)17(31-11)10-16-19(30)23-18(26)25(21(16)35-23)36-15-8-6-5-7-9-15/h5-9,11,16-18,20-25H,10H2,1-4H3/t11-,16+,17-,18-,20+,21-,22+,23-,24+,25+/m0/s1 |
| InChIKey | FIHDOCQJNKCQCE-WREYVAQVSA-N |
| XLogP | 1.35 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.91 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|