C10H15ClO5 — CID 59591654
[(3S,4S)-4-acetyloxy-5-(chloromethyl)-2-methyloxolan-3-yl] acetate (PubChem CID 59591654) has the molecular formula C10H15ClO5 and a molecular weight of 250.68 g/mol. Its IUPAC name is [(3S,4S)-4-acetyloxy-5-(chloromethyl)-2-methyloxolan-3-yl] acetate.
| Compound Name | [(3S,4S)-4-acetyloxy-5-(chloromethyl)-2-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 59591654 |
| Molecular Formula | C10H15ClO5 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | [(3S,4S)-4-acetyloxy-5-(chloromethyl)-2-methyloxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(CCl)OC(C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H15ClO5/c1-5-9(15-6(2)12)10(16-7(3)13)8(4-11)14-5/h5,8-10H,4H2,1-3H3/t5?,8?,9-,10+/m0/s1 |
| InChIKey | ZICZWNOARLROEC-ZUHKJQNLSA-N |
| XLogP | 0.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|