C12H17ClO7 — CID 118225451
[(2S,3R,4S,6R)-3,6-diacetyloxy-2-(chloromethyl)oxan-4-yl] acetate (PubChem CID 118225451) has the molecular formula C12H17ClO7 and a molecular weight of 308.71 g/mol. Its IUPAC name is [(2S,3R,4S,6R)-3,6-diacetyloxy-2-(chloromethyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,6R)-3,6-diacetyloxy-2-(chloromethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 118225451 |
| Molecular Formula | C12H17ClO7 |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | [(2S,3R,4S,6R)-3,6-diacetyloxy-2-(chloromethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](CCl)O1 |
| InChI | InChI=1S/C12H17ClO7/c1-6(14)17-9-4-11(18-7(2)15)20-10(5-13)12(9)19-8(3)16/h9-12H,4-5H2,1-3H3/t9-,10+,11-,12+/m0/s1 |
| InChIKey | MESKOFKDSYLOJM-WHOHXGKFSA-N |
| XLogP | 0.77 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|