C14H23NO8 — CID 167273251
[(2R,3R,4R)-3-acetyloxy-2-(hydroxymethyl)-6-(propylcarbamoyloxy)oxan-4-yl] acetate (PubChem CID 167273251) has the molecular formula C14H23NO8 and a molecular weight of 333.34 g/mol. Its IUPAC name is [(2R,3R,4R)-3-acetyloxy-2-(hydroxymethyl)-6-(propylcarbamoyloxy)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4R)-3-acetyloxy-2-(hydroxymethyl)-6-(propylcarbamoyloxy)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 167273251 |
| Molecular Formula | C14H23NO8 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | [(2R,3R,4R)-3-acetyloxy-2-(hydroxymethyl)-6-(propylcarbamoyloxy)oxan-4-yl] acetate |
| SMILES | CCCNC(=O)OC1C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](CO)O1 |
| InChI | InChI=1S/C14H23NO8/c1-4-5-15-14(19)23-12-6-10(20-8(2)17)13(21-9(3)18)11(7-16)22-12/h10-13,16H,4-7H2,1-3H3,(H,15,19)/t10-,11-,12?,13-/m1/s1 |
| InChIKey | VCMXKYKQJIDBRV-ZHRBOBAGSA-N |
| XLogP | 0.09 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|