C12H15F3O7 — CID 67569005
[(2S,3R,4R,6R)-3,6-diacetyloxy-2-(trifluoromethyl)oxan-4-yl] acetate (PubChem CID 67569005) has the molecular formula C12H15F3O7 and a molecular weight of 328.24 g/mol. Its IUPAC name is [(2S,3R,4R,6R)-3,6-diacetyloxy-2-(trifluoromethyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,6R)-3,6-diacetyloxy-2-(trifluoromethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 67569005 |
| Molecular Formula | C12H15F3O7 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | [(2S,3R,4R,6R)-3,6-diacetyloxy-2-(trifluoromethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C12H15F3O7/c1-5(16)19-8-4-9(20-6(2)17)22-11(12(13,14)15)10(8)21-7(3)18/h8-11H,4H2,1-3H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | YYLWRWFBUHDJGZ-YTWAJWBKSA-N |
| XLogP | 1.09 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|