C11H10F6O7 — CID 44518465
[(2R,3S)-5-acetyloxy-3-(2,2,2-trifluoroacetyl)oxyoxolan-2-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 44518465) has the molecular formula C11H10F6O7 and a molecular weight of 368.18 g/mol. Its IUPAC name is [(2R,3S)-5-acetyloxy-3-(2,2,2-trifluoroacetyl)oxyoxolan-2-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(2R,3S)-5-acetyloxy-3-(2,2,2-trifluoroacetyl)oxyoxolan-2-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 44518465 |
| Molecular Formula | C11H10F6O7 |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | [(2R,3S)-5-acetyloxy-3-(2,2,2-trifluoroacetyl)oxyoxolan-2-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | CC(=O)OC1C[C@H](OC(=O)C(F)(F)F)[C@@H](COC(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C11H10F6O7/c1-4(18)22-7-2-5(24-9(20)11(15,16)17)6(23-7)3-21-8(19)10(12,13)14/h5-7H,2-3H2,1H3/t5-,6+,7?/m0/s1 |
| InChIKey | BITJKLVMNQNDGW-GFCOJPQKSA-N |
| XLogP | 1.24 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|