About (3-methyloxolan-2-yl) benzenesulfonate
(3-methyloxolan-2-yl) benzenesulfonate (PubChem CID 141025105) has the molecular formula C11H14O4S
and a molecular weight of 242.30 g/mol. Its IUPAC name is (3-methyloxolan-2-yl) benzenesulfonate.
Molecular Properties
| Compound Name | (3-methyloxolan-2-yl) benzenesulfonate |
| PubChem CID | 141025105 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (3-methyloxolan-2-yl) benzenesulfonate |
| SMILES | CC1CCOC1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O4S/c1-9-7-8-14-11(9)15-16(12,13)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3 |
| InChIKey | JSABFCJJRMQSGF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methyloxolan-2-yl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxolan-2-yl) benzenesulfonate?
The IUPAC name of (3-methyloxolan-2-yl) benzenesulfonate (CID 141025105) is (3-methyloxolan-2-yl) benzenesulfonate.
What is the SMILES notation for (3-methyloxolan-2-yl) benzenesulfonate?
The canonical SMILES for (3-methyloxolan-2-yl) benzenesulfonate is CC1CCOC1OS(=O)(=O)c1ccccc1.
What is the InChIKey of (3-methyloxolan-2-yl) benzenesulfonate?
The InChIKey is JSABFCJJRMQSGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4S/c1-9-7-8-14-11(9)15-16(12,13)10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3.
What are the key properties of (3-methyloxolan-2-yl) benzenesulfonate?
(3-methyloxolan-2-yl) benzenesulfonate has a molecular weight of 242.30 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxolan-2-yl) benzenesulfonate is sourced from PubChem (CID 141025105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).