C18H18OSe — CID 23254001
trans-(2S,3R)-3-phenyl-2-phenylselanylcyclohexan-1-one (PubChem CID 23254001) has the molecular formula C18H18OSe and a molecular weight of 329.30 g/mol. Its IUPAC name is trans-(2S,3R)-3-phenyl-2-phenylselanylcyclohexan-1-one.
| Compound Name | trans-(2S,3R)-3-phenyl-2-phenylselanylcyclohexan-1-one |
|---|---|
| PubChem CID | 23254001 |
| Molecular Formula | C18H18OSe |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | trans-(2S,3R)-3-phenyl-2-phenylselanylcyclohexan-1-one |
| SMILES | O=C1CCC[C@H](c2ccccc2)[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C18H18OSe/c19-17-13-7-12-16(14-8-3-1-4-9-14)18(17)20-15-10-5-2-6-11-15/h1-6,8-11,16,18H,7,12-13H2/t16-,18+/m1/s1 |
| InChIKey | QBFYPGUIJSVFMP-AEFFLSMTSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|