C15H19NO — CID 71565216
(3R,3aS,8aS)-3-phenyl-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclohepta[b]pyrrol-4-one (PubChem CID 71565216) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (3R,3aS,8aS)-3-phenyl-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclohepta[b]pyrrol-4-one.
| Compound Name | (3R,3aS,8aS)-3-phenyl-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclohepta[b]pyrrol-4-one |
|---|---|
| PubChem CID | 71565216 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (3R,3aS,8aS)-3-phenyl-2,3,3a,5,6,7,8,8a-octahydro-1H-cyclohepta[b]pyrrol-4-one |
| SMILES | O=C1CCCC[C@@H]2NC[C@@H](c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C15H19NO/c17-14-9-5-4-8-13-15(14)12(10-16-13)11-6-2-1-3-7-11/h1-3,6-7,12-13,15-16H,4-5,8-10H2/t12-,13-,15-/m0/s1 |
| InChIKey | FBODYRRHMNRLID-YDHLFZDLSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |