C12H14N2O — CID 11735828
(1R,5R,6S)-6-phenyl-2,4-diazabicyclo[3.2.1]octan-3-one (PubChem CID 11735828) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (1R,5R,6S)-6-phenyl-2,4-diazabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,5R,6S)-6-phenyl-2,4-diazabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 11735828 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (1R,5R,6S)-6-phenyl-2,4-diazabicyclo[3.2.1]octan-3-one |
| SMILES | O=C1N[C@H]2C[C@@H](N1)[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C12H14N2O/c15-12-13-9-6-10(11(7-9)14-12)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2,(H2,13,14,15)/t9-,10+,11-/m1/s1 |
| InChIKey | NFWTZWNYCKZYRT-OUAUKWLOSA-N |
| XLogP | 1.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |