C16H16Se — CID 10613263
1-phenylselanyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 10613263) has the molecular formula C16H16Se and a molecular weight of 287.26 g/mol. Its IUPAC name is 1-phenylselanyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-phenylselanyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 10613263 |
| Molecular Formula | C16H16Se |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-phenylselanyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | c1ccc([Se]C2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H16Se/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16/h1-5,7,9-11,16H,6,8,12H2 |
| InChIKey | FMONPGUJTQVMOK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|