C22H26 — CID 173460746
1-(1-phenylcyclohexyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 173460746) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-(1-phenylcyclohexyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-(1-phenylcyclohexyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 173460746 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-(1-phenylcyclohexyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | c1ccc(C2(C3CCCc4ccccc43)CCCCC2)cc1 |
| InChI | InChI=1S/C22H26/c1-3-12-19(13-4-1)22(16-7-2-8-17-22)21-15-9-11-18-10-5-6-14-20(18)21/h1,3-6,10,12-14,21H,2,7-9,11,15-17H2 |
| InChIKey | YRLDVCLNUIPIKB-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |