C11H14OSe — CID 12779062
cis-(1S,2R)-2-phenylselanylcyclopentan-1-ol (PubChem CID 12779062) has the molecular formula C11H14OSe and a molecular weight of 241.19 g/mol. Its IUPAC name is cis-(1S,2R)-2-phenylselanylcyclopentan-1-ol.
| Compound Name | cis-(1S,2R)-2-phenylselanylcyclopentan-1-ol |
|---|---|
| PubChem CID | 12779062 |
| Molecular Formula | C11H14OSe |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | cis-(1S,2R)-2-phenylselanylcyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C11H14OSe/c12-10-7-4-8-11(10)13-9-5-2-1-3-6-9/h1-3,5-6,10-12H,4,7-8H2/t10-,11+/m0/s1 |
| InChIKey | KJWMPIJYRBLYOF-WDEREUQCSA-N |
| XLogP | 1.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|