C15H24OSeSi — CID 11255894
trans-(1R,2R)-2-(4-trimethylsilylphenyl)selanylcyclohexan-1-ol (PubChem CID 11255894) has the molecular formula C15H24OSeSi and a molecular weight of 327.40 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-trimethylsilylphenyl)selanylcyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(4-trimethylsilylphenyl)selanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11255894 |
| Molecular Formula | C15H24OSeSi |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | trans-(1R,2R)-2-(4-trimethylsilylphenyl)selanylcyclohexan-1-ol |
| SMILES | C[Si](C)(C)c1ccc([Se][C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C15H24OSeSi/c1-18(2,3)13-10-8-12(9-11-13)17-15-7-5-4-6-14(15)16/h8-11,14-16H,4-7H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | LFKKZEUDRQEAIE-HUUCEWRRSA-N |
| XLogP | 2.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|