C13H15NSSe — CID 10803865
[(1R,2R)-2-phenylselanylcyclohexyl] thiocyanate (PubChem CID 10803865) has the molecular formula C13H15NSSe and a molecular weight of 296.30 g/mol. Its IUPAC name is [(1R,2R)-2-phenylselanylcyclohexyl] thiocyanate.
| Compound Name | [(1R,2R)-2-phenylselanylcyclohexyl] thiocyanate |
|---|---|
| PubChem CID | 10803865 |
| Molecular Formula | C13H15NSSe |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | [(1R,2R)-2-phenylselanylcyclohexyl] thiocyanate |
| SMILES | N#CS[C@@H]1CCCC[C@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C13H15NSSe/c14-10-15-12-8-4-5-9-13(12)16-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-9H2/t12-,13-/m1/s1 |
| InChIKey | DTAGPCKZTCXOLH-CHWSQXEVSA-N |
| XLogP | 2.96 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|