About (2-hydroxycyclohexyl) thiocyanate
(2-hydroxycyclohexyl) thiocyanate (PubChem CID 11062645) has the molecular formula C7H11NOS
and a molecular weight of 157.24 g/mol. Its IUPAC name is (2-hydroxycyclohexyl) thiocyanate.
Molecular Properties
| Compound Name | (2-hydroxycyclohexyl) thiocyanate |
| PubChem CID | 11062645 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | (2-hydroxycyclohexyl) thiocyanate |
| SMILES | N#CSC1CCCCC1O |
| InChI | InChI=1S/C7H11NOS/c8-5-10-7-4-2-1-3-6(7)9/h6-7,9H,1-4H2 |
| InChIKey | CCTVQTQHCKSZAB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxycyclohexyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxycyclohexyl) thiocyanate?
The IUPAC name of (2-hydroxycyclohexyl) thiocyanate (CID 11062645) is (2-hydroxycyclohexyl) thiocyanate.
What is the SMILES notation for (2-hydroxycyclohexyl) thiocyanate?
The canonical SMILES for (2-hydroxycyclohexyl) thiocyanate is N#CSC1CCCCC1O.
What is the InChIKey of (2-hydroxycyclohexyl) thiocyanate?
The InChIKey is CCTVQTQHCKSZAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NOS/c8-5-10-7-4-2-1-3-6(7)9/h6-7,9H,1-4H2.
What are the key properties of (2-hydroxycyclohexyl) thiocyanate?
(2-hydroxycyclohexyl) thiocyanate has a molecular weight of 157.24 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxycyclohexyl) thiocyanate is sourced from PubChem (CID 11062645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).