C11H13FO — CID 102315049
(2S,3R)-3-fluoro-2-phenyloxane (PubChem CID 102315049) has the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. Its IUPAC name is (2S,3R)-3-fluoro-2-phenyloxane.
| Compound Name | (2S,3R)-3-fluoro-2-phenyloxane |
|---|---|
| PubChem CID | 102315049 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (2S,3R)-3-fluoro-2-phenyloxane |
| SMILES | F[C@@H]1CCCO[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H13FO/c12-10-7-4-8-13-11(10)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2/t10-,11+/m1/s1 |
| InChIKey | RQYDJYUFRWXZPJ-MNOVXSKESA-N |
| XLogP | 2.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |