C7H10O3 — CID 163551138
(5R)-4-hydroxy-6-oxabicyclo[3.2.1]octan-7-one (PubChem CID 163551138) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (5R)-4-hydroxy-6-oxabicyclo[3.2.1]octan-7-one.
| Compound Name | (5R)-4-hydroxy-6-oxabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 163551138 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (5R)-4-hydroxy-6-oxabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1O[C@@H]2CC1CCC2O |
| InChI | InChI=1S/C7H10O3/c8-5-2-1-4-3-6(5)10-7(4)9/h4-6,8H,1-3H2/t4?,5?,6-/m1/s1 |
| InChIKey | FJEHNJSXWDSJJG-JMMWHDCWSA-N |
| XLogP | 0.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |