C17H20O2 — CID 824554
(1R)-5,5-dimethyl-1-phenyl-4,6,7,8-tetrahydro-1H-isochromen-3-one (PubChem CID 824554) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (1R)-5,5-dimethyl-1-phenyl-4,6,7,8-tetrahydro-1H-isochromen-3-one.
| Compound Name | (1R)-5,5-dimethyl-1-phenyl-4,6,7,8-tetrahydro-1H-isochromen-3-one |
|---|---|
| PubChem CID | 824554 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (1R)-5,5-dimethyl-1-phenyl-4,6,7,8-tetrahydro-1H-isochromen-3-one |
| SMILES | CC1(C)CCCC2=C1CC(=O)O[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-17(2)10-6-9-13-14(17)11-15(18)19-16(13)12-7-4-3-5-8-12/h3-5,7-8,16H,6,9-11H2,1-2H3/t16-/m1/s1 |
| InChIKey | GIRNTLYZPDTGAI-MRXNPFEDSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|