C50H56O16 — CID 139183998
(1R,20R,22S,23S,24S,26R,30R)-24-methoxy-8,13,21,25,28,29,31-heptaoxahexacyclo[20.6.2.120,23.02,7.014,19.026,30]hentriaconta-2,4,6,14,16,18-hexaene (PubChem CID 139183998) has the molecular formula C50H56O16 and a molecular weight of 912.98 g/mol. Its IUPAC name is (1R,20R,22S,23S,24S,26R,30R)-24-methoxy-8,13,21,25,28,29,31-heptaoxahexacyclo[20.6.2.120,23.02,7.014,19.026,30]hentriaconta-2,4,6,14,16,18-hexaene.
| Compound Name | (1R,20R,22S,23S,24S,26R,30R)-24-methoxy-8,13,21,25,28,29,31-heptaoxahexacyclo[20.6.2.120,23.02,7.014,19.026,30]hentriaconta-2,4,6,14,16,18-hexaene |
|---|---|
| PubChem CID | 139183998 |
| Molecular Formula | C50H56O16 |
| Molecular Weight | 912.98 g/mol |
| Exact Mass | 912.36 |
| IUPAC Name | (1R,20R,22S,23S,24S,26R,30R)-24-methoxy-8,13,21,25,28,29,31-heptaoxahexacyclo[20.6.2.120,23.02,7.014,19.026,30]hentriaconta-2,4,6,14,16,18-hexaene |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H]3O[C@H]2[C@@H]2O[C@H](O[C@H]12)c1ccccc1OCCCCOc1ccccc13.CO[C@H]1O[C@@H]2CO[C@@H]3O[C@H]2[C@@H]2O[C@H](O[C@H]12)c1ccccc1OCCCCOc1ccccc13 |
| InChI | InChI=1S/2C25H28O8/c2*1-26-25-22-21-20-19(30-25)14-29-23(31-20)15-8-2-4-10-17(15)27-12-6-7-13-28-18-11-5-3-9-16(18)24(32-21)33-22/h2*2-5,8-11,19-25H,6-7,12-14H2,1H3/t2*19-,20-,21+,22+,23-,24-,25+/m11/s1 |
| InChIKey | ADOMSJVLDZGQDO-QZSGDMSVSA-N |
| XLogP | 7.01 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.98 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |