C25H28O8 — CID 101186889
(1R,20R,22S,23S,24S,26R,30R)-24-methoxy-8,13,21,25,28,29,31-heptaoxahexacyclo[20.6.2.120,23.02,7.014,19.026,30]hentriaconta-2,4,6,14,16,18-hexaene (PubChem CID 101186889) has the molecular formula C25H28O8 and a molecular weight of 456.49 g/mol. Its IUPAC name is (1R,20R,22S,23S,24S,26R,30R)-24-methoxy-8,13,21,25,28,29,31-heptaoxahexacyclo[20.6.2.120,23.02,7.014,19.026,30]hentriaconta-2,4,6,14,16,18-hexaene.
| Compound Name | (1R,20R,22S,23S,24S,26R,30R)-24-methoxy-8,13,21,25,28,29,31-heptaoxahexacyclo[20.6.2.120,23.02,7.014,19.026,30]hentriaconta-2,4,6,14,16,18-hexaene |
|---|---|
| PubChem CID | 101186889 |
| Molecular Formula | C25H28O8 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (1R,20R,22S,23S,24S,26R,30R)-24-methoxy-8,13,21,25,28,29,31-heptaoxahexacyclo[20.6.2.120,23.02,7.014,19.026,30]hentriaconta-2,4,6,14,16,18-hexaene |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H]3O[C@H]2[C@@H]2O[C@H](O[C@H]12)c1ccccc1OCCCCOc1ccccc13 |
| InChI | InChI=1S/C25H28O8/c1-26-25-22-21-20-19(30-25)14-29-23(31-20)15-8-2-4-10-17(15)27-12-6-7-13-28-18-11-5-3-9-16(18)24(32-21)33-22/h2-5,8-11,19-25H,6-7,12-14H2,1H3/t19-,20-,21+,22+,23-,24-,25+/m1/s1 |
| InChIKey | GHXHNHICOKFZND-XWERMIHBSA-N |
| XLogP | 3.51 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |