C21H20N2O10 — CID 102020077
(1R,2S,4S,6S,7S,9R)-7-methoxy-4,12-bis(2-nitrophenyl)-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 102020077) has the molecular formula C21H20N2O10 and a molecular weight of 460.40 g/mol. Its IUPAC name is (1R,2S,4S,6S,7S,9R)-7-methoxy-4,12-bis(2-nitrophenyl)-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1R,2S,4S,6S,7S,9R)-7-methoxy-4,12-bis(2-nitrophenyl)-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 102020077 |
| Molecular Formula | C21H20N2O10 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (1R,2S,4S,6S,7S,9R)-7-methoxy-4,12-bis(2-nitrophenyl)-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3[N+](=O)[O-])O[C@H]2[C@@H]2O[C@H](c3ccccc3[N+](=O)[O-])O[C@H]12 |
| InChI | InChI=1S/C21H20N2O10/c1-28-21-18-17(32-20(33-18)12-7-3-5-9-14(12)23(26)27)16-15(30-21)10-29-19(31-16)11-6-2-4-8-13(11)22(24)25/h2-9,15-21H,10H2,1H3/t15-,16-,17+,18+,19?,20+,21+/m1/s1 |
| InChIKey | MKPICZLOPLTMFV-IZADQZEBSA-N |
| XLogP | 2.77 |
| TPSA | 141.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|