C14H14O5 — CID 165341801
cis-methyl (1S,2S)-2-hydroxy-4,6-dioxo-2-phenylcyclohexane-1-carboxylate (PubChem CID 165341801) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is cis-methyl (1S,2S)-2-hydroxy-4,6-dioxo-2-phenylcyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1S,2S)-2-hydroxy-4,6-dioxo-2-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 165341801 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | cis-methyl (1S,2S)-2-hydroxy-4,6-dioxo-2-phenylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)CC(=O)C[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C14H14O5/c1-19-13(17)12-11(16)7-10(15)8-14(12,18)9-5-3-2-4-6-9/h2-6,12,18H,7-8H2,1H3/t12-,14+/m0/s1 |
| InChIKey | XCCXCMLJENNYPX-GXTWGEPZSA-N |
| XLogP | 0.60 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|