C26H25NO5 — CID 102517818
dimethyl (2R,3R,5S)-5-hydroxy-1,2,3-triphenylpyrrolidine-2,5-dicarboxylate (PubChem CID 102517818) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is dimethyl (2R,3R,5S)-5-hydroxy-1,2,3-triphenylpyrrolidine-2,5-dicarboxylate.
| Compound Name | dimethyl (2R,3R,5S)-5-hydroxy-1,2,3-triphenylpyrrolidine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 102517818 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | dimethyl (2R,3R,5S)-5-hydroxy-1,2,3-triphenylpyrrolidine-2,5-dicarboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)[C@@H](c2ccccc2)C[C@](O)(C(=O)OC)N1c1ccccc1 |
| InChI | InChI=1S/C26H25NO5/c1-31-23(28)25(30)18-22(19-12-6-3-7-13-19)26(24(29)32-2,20-14-8-4-9-15-20)27(25)21-16-10-5-11-17-21/h3-17,22,30H,18H2,1-2H3/t22-,25+,26+/m1/s1 |
| InChIKey | YWGYKIPESOXFJQ-RZFJZAQRSA-N |
| XLogP | 3.61 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |