C18H21N — CID 64687004
3-benzyl-4,7-dimethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 64687004) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is 3-benzyl-4,7-dimethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-benzyl-4,7-dimethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 64687004 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 3-benzyl-4,7-dimethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1ccc2c(c1)CNC(Cc1ccccc1)C2C |
| InChI | InChI=1S/C18H21N/c1-13-8-9-17-14(2)18(19-12-16(17)10-13)11-15-6-4-3-5-7-15/h3-10,14,18-19H,11-12H2,1-2H3 |
| InChIKey | FFLOSHOTVDNQLN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |