C14H19N — CID 84733856
1-cyclopentyl-5-methyl-2,3-dihydro-1H-isoindole (PubChem CID 84733856) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-cyclopentyl-5-methyl-2,3-dihydro-1H-isoindole.
| Compound Name | 1-cyclopentyl-5-methyl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 84733856 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-cyclopentyl-5-methyl-2,3-dihydro-1H-isoindole |
| SMILES | Cc1ccc2c(c1)CNC2C1CCCC1 |
| InChI | InChI=1S/C14H19N/c1-10-6-7-13-12(8-10)9-15-14(13)11-4-2-3-5-11/h6-8,11,14-15H,2-5,9H2,1H3 |
| InChIKey | YAIQDCQPQMTKBB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |