C18H24N2O2 — CID 2662586
(5R)-5-cyclohexyl-3-[(2,5-dimethylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 2662586) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (5R)-5-cyclohexyl-3-[(2,5-dimethylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-cyclohexyl-3-[(2,5-dimethylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2662586 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (5R)-5-cyclohexyl-3-[(2,5-dimethylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C)c(CN2C(=O)N[C@H](C3CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C18H24N2O2/c1-12-8-9-13(2)15(10-12)11-20-17(21)16(19-18(20)22)14-6-4-3-5-7-14/h8-10,14,16H,3-7,11H2,1-2H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | JBKZFTPFWWQFNV-MRXNPFEDSA-N |
| XLogP | 3.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|