C17H21FN2O3 — CID 2633906
(5S)-5-cyclohexyl-3-[(3-fluoro-4-methoxyphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 2633906) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is (5S)-5-cyclohexyl-3-[(3-fluoro-4-methoxyphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-cyclohexyl-3-[(3-fluoro-4-methoxyphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2633906 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (5S)-5-cyclohexyl-3-[(3-fluoro-4-methoxyphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)N[C@@H](C3CCCCC3)C2=O)cc1F |
| InChI | InChI=1S/C17H21FN2O3/c1-23-14-8-7-11(9-13(14)18)10-20-16(21)15(19-17(20)22)12-5-3-2-4-6-12/h7-9,12,15H,2-6,10H2,1H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | QICVTXKZGBHBIK-HNNXBMFYSA-N |
| XLogP | 2.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|