C13H17NO — CID 84733976
1-cyclopentyl-2,3-dihydro-1H-isoindol-4-ol (PubChem CID 84733976) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-cyclopentyl-2,3-dihydro-1H-isoindol-4-ol.
| Compound Name | 1-cyclopentyl-2,3-dihydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 84733976 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-cyclopentyl-2,3-dihydro-1H-isoindol-4-ol |
| SMILES | Oc1cccc2c1CNC2C1CCCC1 |
| InChI | InChI=1S/C13H17NO/c15-12-7-3-6-10-11(12)8-14-13(10)9-4-1-2-5-9/h3,6-7,9,13-15H,1-2,4-5,8H2 |
| InChIKey | VSVPOMLZATUGGD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|