C8H15O5PS — CID 170686947
2-ethenoxy-2-sulfanylidene-1,3,6,9-tetraoxa-2λ5-phosphacycloundecane (PubChem CID 170686947) has the molecular formula C8H15O5PS and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-ethenoxy-2-sulfanylidene-1,3,6,9-tetraoxa-2λ5-phosphacycloundecane.
| Compound Name | 2-ethenoxy-2-sulfanylidene-1,3,6,9-tetraoxa-2λ5-phosphacycloundecane |
|---|---|
| PubChem CID | 170686947 |
| Molecular Formula | C8H15O5PS |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-ethenoxy-2-sulfanylidene-1,3,6,9-tetraoxa-2λ5-phosphacycloundecane |
| SMILES | C=COP1(=S)OCCOCCOCCO1 |
| InChI | InChI=1S/C8H15O5PS/c1-2-11-14(15)12-7-5-9-3-4-10-6-8-13-14/h2H,1,3-8H2 |
| InChIKey | KZOSITYEWICLEC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|