About (114C)but-3-enamide
(114C)but-3-enamide (PubChem CID 173004196) has the molecular formula C4H7NO
and a molecular weight of 87.10 g/mol. Its IUPAC name is (114C)but-3-enamide.
Molecular Properties
| Compound Name | (114C)but-3-enamide |
| PubChem CID | 173004196 |
| Molecular Formula | C4H7NO |
| Molecular Weight | 87.10 g/mol |
| Exact Mass | 87.06 |
| IUPAC Name | (114C)but-3-enamide |
| SMILES | C=CC[14C](N)=O |
| InChI | InChI=1S/C4H7NO/c1-2-3-4(5)6/h2H,1,3H2,(H2,5,6)/i4+2 |
| InChIKey | ABBZJHFBQXYTLU-DOMIDYPGSA-N |
| XLogP | 0.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.10 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (114C)but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (114C)but-3-enamide?
The IUPAC name of (114C)but-3-enamide (CID 173004196) is (114C)but-3-enamide.
What is the SMILES notation for (114C)but-3-enamide?
The canonical SMILES for (114C)but-3-enamide is C=CC[14C](N)=O.
What is the InChIKey of (114C)but-3-enamide?
The InChIKey is ABBZJHFBQXYTLU-DOMIDYPGSA-N. The full InChI is InChI=1S/C4H7NO/c1-2-3-4(5)6/h2H,1,3H2,(H2,5,6)/i4+2.
What are the key properties of (114C)but-3-enamide?
(114C)but-3-enamide has a molecular weight of 87.10 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (114C)but-3-enamide is sourced from PubChem (CID 173004196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).