About dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane
dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane (PubChem CID 87403767) has the molecular formula C3H5Cs2O3P
and a molecular weight of 385.85 g/mol. Its IUPAC name is dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane.
Molecular Properties
| Compound Name | dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane |
| PubChem CID | 87403767 |
| Molecular Formula | C3H5Cs2O3P |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.81 |
| IUPAC Name | dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane |
| SMILES | C=CCP(=O)([O-])[O-].[Cs+].[Cs+] |
| InChI | InChI=1S/C3H7O3P.2Cs/c1-2-3-7(4,5)6;;/h2H,1,3H2,(H2,4,5,6);;/q;2*+1/p-2 |
| InChIKey | UTXZJOSYOVZDOR-UHFFFAOYSA-L |
| XLogP | -6.91 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | -6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane?
The IUPAC name of dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane (CID 87403767) is dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane.
What is the SMILES notation for dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane?
The canonical SMILES for dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane is C=CCP(=O)([O-])[O-].[Cs+].[Cs+].
What is the InChIKey of dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane?
The InChIKey is UTXZJOSYOVZDOR-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H7O3P.2Cs/c1-2-3-7(4,5)6;;/h2H,1,3H2,(H2,4,5,6);;/q;2*+1/p-2.
What are the key properties of dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane?
dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane has a molecular weight of 385.85 g/mol, XLogP of -6.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dicesium;dioxido-oxo-prop-2-enyl-λ5-phosphane is sourced from PubChem (CID 87403767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).