C9H22NO4P — CID 173387708
dihydrogen phosphate;triethyl(prop-2-enyl)azanium (PubChem CID 173387708) has the molecular formula C9H22NO4P and a molecular weight of 239.25 g/mol. Its IUPAC name is dihydrogen phosphate;triethyl(prop-2-enyl)azanium.
| Compound Name | dihydrogen phosphate;triethyl(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 173387708 |
| Molecular Formula | C9H22NO4P |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | dihydrogen phosphate;triethyl(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC)(CC)CC.O=P([O-])(O)O |
| InChI | InChI=1S/C9H20N.H3O4P/c1-5-9-10(6-2,7-3)8-4;1-5(2,3)4/h5H,1,6-9H2,2-4H3;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | FXERHRIWMOQVBG-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|