About zinc;hydrogen phosphate;1-(propyldisulfanyl)propane
zinc;hydrogen phosphate;1-(propyldisulfanyl)propane (PubChem CID 174694576) has the molecular formula C6H15O4PS2Zn
and a molecular weight of 311.68 g/mol. Its IUPAC name is zinc;hydrogen phosphate;1-(propyldisulfanyl)propane.
Molecular Properties
| Compound Name | zinc;hydrogen phosphate;1-(propyldisulfanyl)propane |
| PubChem CID | 174694576 |
| Molecular Formula | C6H15O4PS2Zn |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | zinc;hydrogen phosphate;1-(propyldisulfanyl)propane |
| SMILES | CCCSSCCC.O=P([O-])([O-])O.[Zn+2] |
| InChI | InChI=1S/C6H14S2.H3O4P.Zn/c1-3-5-7-8-6-4-2;1-5(2,3)4;/h3-6H2,1-2H3;(H3,1,2,3,4);/q;;+2/p-2 |
| InChIKey | OZAOYPDUJDDFMW-UHFFFAOYSA-L |
| XLogP | 0.99 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc;hydrogen phosphate;1-(propyldisulfanyl)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;hydrogen phosphate;1-(propyldisulfanyl)propane?
The IUPAC name of zinc;hydrogen phosphate;1-(propyldisulfanyl)propane (CID 174694576) is zinc;hydrogen phosphate;1-(propyldisulfanyl)propane.
What is the SMILES notation for zinc;hydrogen phosphate;1-(propyldisulfanyl)propane?
The canonical SMILES for zinc;hydrogen phosphate;1-(propyldisulfanyl)propane is CCCSSCCC.O=P([O-])([O-])O.[Zn+2].
What is the InChIKey of zinc;hydrogen phosphate;1-(propyldisulfanyl)propane?
The InChIKey is OZAOYPDUJDDFMW-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H14S2.H3O4P.Zn/c1-3-5-7-8-6-4-2;1-5(2,3)4;/h3-6H2,1-2H3;(H3,1,2,3,4);/q;;+2/p-2.
What are the key properties of zinc;hydrogen phosphate;1-(propyldisulfanyl)propane?
zinc;hydrogen phosphate;1-(propyldisulfanyl)propane has a molecular weight of 311.68 g/mol, XLogP of 0.99, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;hydrogen phosphate;1-(propyldisulfanyl)propane is sourced from PubChem (CID 174694576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).