C13H25NO2 — CID 174488923
but-3-enoate;triethyl(prop-2-enyl)azanium (PubChem CID 174488923) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is but-3-enoate;triethyl(prop-2-enyl)azanium.
| Compound Name | but-3-enoate;triethyl(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 174488923 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | but-3-enoate;triethyl(prop-2-enyl)azanium |
| SMILES | C=CCC(=O)[O-].C=CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C9H20N.C4H6O2/c1-5-9-10(6-2,7-3)8-4;1-2-3-4(5)6/h5H,1,6-9H2,2-4H3;2H,1,3H2,(H,5,6)/q+1;/p-1 |
| InChIKey | WCZMNDFMNYOIAB-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|