About azanium but-3-enoate
azanium but-3-enoate (PubChem CID 87111540) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is azanium but-3-enoate.
Molecular Properties
| Compound Name | azanium but-3-enoate |
| PubChem CID | 87111540 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | azanium but-3-enoate |
| SMILES | C=CCC(=O)[O-].[NH4+] |
| InChI | InChI=1S/C4H6O2.H3N/c1-2-3-4(5)6;/h2H,1,3H2,(H,5,6);1H3 |
| InChIKey | OLPDYDWAPLLGDD-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azanium but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium but-3-enoate?
The IUPAC name of azanium but-3-enoate (CID 87111540) is azanium but-3-enoate.
What is the SMILES notation for azanium but-3-enoate?
The canonical SMILES for azanium but-3-enoate is C=CCC(=O)[O-].[NH4+].
What is the InChIKey of azanium but-3-enoate?
The InChIKey is OLPDYDWAPLLGDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.H3N/c1-2-3-4(5)6;/h2H,1,3H2,(H,5,6);1H3.
What are the key properties of azanium but-3-enoate?
azanium but-3-enoate has a molecular weight of 103.12 g/mol, XLogP of -0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium but-3-enoate is sourced from PubChem (CID 87111540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).