About oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium
oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium (PubChem CID 174712205) has the molecular formula C12H20NO4Re
and a molecular weight of 428.50 g/mol. Its IUPAC name is oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium |
| PubChem CID | 174712205 |
| Molecular Formula | C12H20NO4Re |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)(CC=C)CC=C.O=[Re](=O)(=O)[O-] |
| InChI | InChI=1S/C12H20N.4O.Re/c1-5-9-13(10-6-2,11-7-3)12-8-4;;;;;/h5-8H,1-4,9-12H2;;;;;/q+1;;;;-1; |
| InChIKey | FNFDNIMEAQGNCM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium?
The IUPAC name of oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium (CID 174712205) is oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium.
What is the SMILES notation for oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium?
The canonical SMILES for oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium is C=CC[N+](CC=C)(CC=C)CC=C.O=[Re](=O)(=O)[O-].
What is the InChIKey of oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium?
The InChIKey is FNFDNIMEAQGNCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N.4O.Re/c1-5-9-13(10-6-2,11-7-3)12-8-4;;;;;/h5-8H,1-4,9-12H2;;;;;/q+1;;;;-1;.
What are the key properties of oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium?
oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium has a molecular weight of 428.50 g/mol, XLogP of 1.00, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxido(trioxo)rhenium;tetrakis(prop-2-enyl)azanium is sourced from PubChem (CID 174712205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).