About N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium
N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium (PubChem CID 174867425) has the molecular formula C18H31N2+
and a molecular weight of 275.46 g/mol. Its IUPAC name is N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium |
| PubChem CID | 174867425 |
| Molecular Formula | C18H31N2+ |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium |
| SMILES | C=CCNCC=C.C=CC[N+](CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C12H20N.C6H11N/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-3-5-7-6-4-2/h5-8H,1-4,9-12H2;3-4,7H,1-2,5-6H2/q+1; |
| InChIKey | VBRALOHDVXUZMB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium?
The IUPAC name of N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium (CID 174867425) is N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium.
What is the SMILES notation for N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium?
The canonical SMILES for N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium is C=CCNCC=C.C=CC[N+](CC=C)(CC=C)CC=C.
What is the InChIKey of N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium?
The InChIKey is VBRALOHDVXUZMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N.C6H11N/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-3-5-7-6-4-2/h5-8H,1-4,9-12H2;3-4,7H,1-2,5-6H2/q+1;.
What are the key properties of N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium?
N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium has a molecular weight of 275.46 g/mol, XLogP of 3.50, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enylprop-2-en-1-amine;tetrakis(prop-2-enyl)azanium is sourced from PubChem (CID 174867425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).