C3H5Na2O4P — CID 87157623
disodium;prop-2-enyl phosphate (PubChem CID 87157623) has the molecular formula C3H5Na2O4P and a molecular weight of 182.02 g/mol. Its IUPAC name is disodium;prop-2-enyl phosphate.
| Compound Name | disodium;prop-2-enyl phosphate |
|---|---|
| PubChem CID | 87157623 |
| Molecular Formula | C3H5Na2O4P |
| Molecular Weight | 182.02 g/mol |
| Exact Mass | 181.97 |
| IUPAC Name | disodium;prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C3H7O4P.2Na/c1-2-3-7-8(4,5)6;;/h2H,1,3H2,(H2,4,5,6);;/q;2*+1/p-2 |
| InChIKey | CTTMFEMSISLOCS-UHFFFAOYSA-L |
| XLogP | -6.97 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.02 |
| LogP ≤ 5 | -6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|