About bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+)
bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+) (PubChem CID 87309852) has the molecular formula C6H10O4P2S4Ti
and a molecular weight of 384.23 g/mol. Its IUPAC name is bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+).
Molecular Properties
| Compound Name | bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+) |
| PubChem CID | 87309852 |
| Molecular Formula | C6H10O4P2S4Ti |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.84 |
| IUPAC Name | bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+) |
| SMILES | C=CCOP([O-])(=S)[S-].C=CCOP([O-])(=S)[S-].[Ti+4] |
| InChI | InChI=1S/2C3H7O2PS2.Ti/c2*1-2-3-5-6(4,7)8;/h2*2H,1,3H2,(H2,4,7,8);/q;;+4/p-4 |
| InChIKey | OEYHDZNLNAMMHW-UHFFFAOYSA-J |
| XLogP | 0.64 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+)?
The IUPAC name of bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+) (CID 87309852) is bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+).
What is the SMILES notation for bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+)?
The canonical SMILES for bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+) is C=CCOP([O-])(=S)[S-].C=CCOP([O-])(=S)[S-].[Ti+4].
What is the InChIKey of bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+)?
The InChIKey is OEYHDZNLNAMMHW-UHFFFAOYSA-J. The full InChI is InChI=1S/2C3H7O2PS2.Ti/c2*1-2-3-5-6(4,7)8;/h2*2H,1,3H2,(H2,4,7,8);/q;;+4/p-4.
What are the key properties of bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+)?
bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+) has a molecular weight of 384.23 g/mol, XLogP of 0.64, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane);titanium(4+) is sourced from PubChem (CID 87309852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).