About iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane
iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane (PubChem CID 87288661) has the molecular formula C3H5FeO2PS2
and a molecular weight of 224.02 g/mol. Its IUPAC name is iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane.
Molecular Properties
| Compound Name | iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane |
| PubChem CID | 87288661 |
| Molecular Formula | C3H5FeO2PS2 |
| Molecular Weight | 224.02 g/mol |
| Exact Mass | 223.88 |
| IUPAC Name | iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane |
| SMILES | C=CCOP([O-])(=S)[S-].[Fe+2] |
| InChI | InChI=1S/C3H7O2PS2.Fe/c1-2-3-5-6(4,7)8;/h2H,1,3H2,(H2,4,7,8);/q;+2/p-2 |
| InChIKey | BIPQBYYSAZIOGD-UHFFFAOYSA-L |
| XLogP | 0.32 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.02 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane?
The IUPAC name of iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane (CID 87288661) is iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane.
What is the SMILES notation for iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane?
The canonical SMILES for iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane is C=CCOP([O-])(=S)[S-].[Fe+2].
What is the InChIKey of iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane?
The InChIKey is BIPQBYYSAZIOGD-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H7O2PS2.Fe/c1-2-3-5-6(4,7)8;/h2H,1,3H2,(H2,4,7,8);/q;+2/p-2.
What are the key properties of iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane?
iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane has a molecular weight of 224.02 g/mol, XLogP of 0.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);oxido-prop-2-enoxy-sulfanylidene-sulfido-λ5-phosphane is sourced from PubChem (CID 87288661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).