About S-prop-2-enyl 2-hydroxyethanethioate;silver
S-prop-2-enyl 2-hydroxyethanethioate;silver (PubChem CID 88846601) has the molecular formula C5H8AgO2S
and a molecular weight of 240.05 g/mol. Its IUPAC name is S-prop-2-enyl 2-hydroxyethanethioate;silver.
Molecular Properties
| Compound Name | S-prop-2-enyl 2-hydroxyethanethioate;silver |
| PubChem CID | 88846601 |
| Molecular Formula | C5H8AgO2S |
| Molecular Weight | 240.05 g/mol |
| Exact Mass | 238.93 |
| IUPAC Name | S-prop-2-enyl 2-hydroxyethanethioate;silver |
| SMILES | C=CCSC(=O)CO.[Ag] |
| InChI | InChI=1S/C5H8O2S.Ag/c1-2-3-8-5(7)4-6;/h2,6H,1,3-4H2; |
| InChIKey | NTEVWCVHBKESAG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.05 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-prop-2-enyl 2-hydroxyethanethioate;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-prop-2-enyl 2-hydroxyethanethioate;silver?
The IUPAC name of S-prop-2-enyl 2-hydroxyethanethioate;silver (CID 88846601) is S-prop-2-enyl 2-hydroxyethanethioate;silver.
What is the SMILES notation for S-prop-2-enyl 2-hydroxyethanethioate;silver?
The canonical SMILES for S-prop-2-enyl 2-hydroxyethanethioate;silver is C=CCSC(=O)CO.[Ag].
What is the InChIKey of S-prop-2-enyl 2-hydroxyethanethioate;silver?
The InChIKey is NTEVWCVHBKESAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2S.Ag/c1-2-3-8-5(7)4-6;/h2,6H,1,3-4H2;.
What are the key properties of S-prop-2-enyl 2-hydroxyethanethioate;silver?
S-prop-2-enyl 2-hydroxyethanethioate;silver has a molecular weight of 240.05 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-prop-2-enyl 2-hydroxyethanethioate;silver is sourced from PubChem (CID 88846601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).