About S-prop-2-enyl furan-2-carbothioate
S-prop-2-enyl furan-2-carbothioate (PubChem CID 20981613) has the molecular formula C8H8O2S
and a molecular weight of 168.22 g/mol. Its IUPAC name is S-prop-2-enyl furan-2-carbothioate.
Molecular Properties
| Compound Name | S-prop-2-enyl furan-2-carbothioate |
| PubChem CID | 20981613 |
| Molecular Formula | C8H8O2S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | S-prop-2-enyl furan-2-carbothioate |
| SMILES | C=CCSC(=O)c1ccco1 |
| InChI | InChI=1S/C8H8O2S/c1-2-6-11-8(9)7-4-3-5-10-7/h2-5H,1,6H2 |
| InChIKey | QXPLWVMAWBAAER-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-prop-2-enyl furan-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-prop-2-enyl furan-2-carbothioate?
The IUPAC name of S-prop-2-enyl furan-2-carbothioate (CID 20981613) is S-prop-2-enyl furan-2-carbothioate.
What is the SMILES notation for S-prop-2-enyl furan-2-carbothioate?
The canonical SMILES for S-prop-2-enyl furan-2-carbothioate is C=CCSC(=O)c1ccco1.
What is the InChIKey of S-prop-2-enyl furan-2-carbothioate?
The InChIKey is QXPLWVMAWBAAER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S/c1-2-6-11-8(9)7-4-3-5-10-7/h2-5H,1,6H2.
What are the key properties of S-prop-2-enyl furan-2-carbothioate?
S-prop-2-enyl furan-2-carbothioate has a molecular weight of 168.22 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-prop-2-enyl furan-2-carbothioate is sourced from PubChem (CID 20981613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).