About S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate
S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate (PubChem CID 54114361) has the molecular formula C14H16ClNOS
and a molecular weight of 281.81 g/mol. Its IUPAC name is S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate.
Molecular Properties
| Compound Name | S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate |
| PubChem CID | 54114361 |
| Molecular Formula | C14H16ClNOS |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate |
| SMILES | C=CCSC(=O)N(CC=CCl)Cc1ccccc1 |
| InChI | InChI=1S/C14H16ClNOS/c1-2-11-18-14(17)16(10-6-9-15)12-13-7-4-3-5-8-13/h2-9H,1,10-12H2 |
| InChIKey | NJHTVUXCMJYJBD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate?
The IUPAC name of S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate (CID 54114361) is S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate.
What is the SMILES notation for S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate?
The canonical SMILES for S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate is C=CCSC(=O)N(CC=CCl)Cc1ccccc1.
What is the InChIKey of S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate?
The InChIKey is NJHTVUXCMJYJBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClNOS/c1-2-11-18-14(17)16(10-6-9-15)12-13-7-4-3-5-8-13/h2-9H,1,10-12H2.
What are the key properties of S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate?
S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate has a molecular weight of 281.81 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-prop-2-enyl N-benzyl-N-(3-chloroprop-2-enyl)carbamothioate is sourced from PubChem (CID 54114361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).