C12H13Cl2NO — CID 10083827
N-benzyl-2,2-dichloro-N-prop-2-enylacetamide (PubChem CID 10083827) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is N-benzyl-2,2-dichloro-N-prop-2-enylacetamide.
| Compound Name | N-benzyl-2,2-dichloro-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 10083827 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-benzyl-2,2-dichloro-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C12H13Cl2NO/c1-2-8-15(12(16)11(13)14)9-10-6-4-3-5-7-10/h2-7,11H,1,8-9H2 |
| InChIKey | WZZBXOMSMQZTAA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|