C17H17Cl2NO3 — CID 100948475
N-benzyl-2,2-dichloro-3-(furan-2-yl)-3-hydroxy-N-prop-2-enylpropanamide (PubChem CID 100948475) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is N-benzyl-2,2-dichloro-3-(furan-2-yl)-3-hydroxy-N-prop-2-enylpropanamide.
| Compound Name | N-benzyl-2,2-dichloro-3-(furan-2-yl)-3-hydroxy-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 100948475 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | N-benzyl-2,2-dichloro-3-(furan-2-yl)-3-hydroxy-N-prop-2-enylpropanamide |
| SMILES | C=CCN(Cc1ccccc1)C(=O)C(Cl)(Cl)C(O)c1ccco1 |
| InChI | InChI=1S/C17H17Cl2NO3/c1-2-10-20(12-13-7-4-3-5-8-13)16(22)17(18,19)15(21)14-9-6-11-23-14/h2-9,11,15,21H,1,10,12H2 |
| InChIKey | YBKMOJZIFAJZIO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|