C18H16ClNO4 — CID 111969853
N-benzyl-5-chloro-N-[2-(furan-2-yl)-2-hydroxyethyl]furan-2-carboxamide (PubChem CID 111969853) has the molecular formula C18H16ClNO4 and a molecular weight of 345.78 g/mol. Its IUPAC name is N-benzyl-5-chloro-N-[2-(furan-2-yl)-2-hydroxyethyl]furan-2-carboxamide.
| Compound Name | N-benzyl-5-chloro-N-[2-(furan-2-yl)-2-hydroxyethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111969853 |
| Molecular Formula | C18H16ClNO4 |
| Molecular Weight | 345.78 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-benzyl-5-chloro-N-[2-(furan-2-yl)-2-hydroxyethyl]furan-2-carboxamide |
| SMILES | O=C(c1ccc(Cl)o1)N(Cc1ccccc1)CC(O)c1ccco1 |
| InChI | InChI=1S/C18H16ClNO4/c19-17-9-8-16(24-17)18(22)20(11-13-5-2-1-3-6-13)12-14(21)15-7-4-10-23-15/h1-10,14,21H,11-12H2 |
| InChIKey | VMMHYXTULZTSMS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.78 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |