C20H25NO3 — CID 110025714
(Z)-N-benzyl-N-[2-(furan-2-yl)-2-hydroxyethyl]-2,3-dimethylpent-2-enamide (PubChem CID 110025714) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (Z)-N-benzyl-N-[2-(furan-2-yl)-2-hydroxyethyl]-2,3-dimethylpent-2-enamide.
| Compound Name | (Z)-N-benzyl-N-[2-(furan-2-yl)-2-hydroxyethyl]-2,3-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 110025714 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (Z)-N-benzyl-N-[2-(furan-2-yl)-2-hydroxyethyl]-2,3-dimethylpent-2-enamide |
| SMILES | CC/C(C)=C(/C)C(=O)N(Cc1ccccc1)CC(O)c1ccco1 |
| InChI | InChI=1S/C20H25NO3/c1-4-15(2)16(3)20(23)21(13-17-9-6-5-7-10-17)14-18(22)19-11-8-12-24-19/h5-12,18,22H,4,13-14H2,1-3H3/b16-15- |
| InChIKey | HYCIBVCSEJFTRF-NXVVXOECSA-N |
| XLogP | 4.09 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|