C16H22N2O — CID 54808897
2-[benzyl(methyl)amino]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 54808897) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[benzyl(methyl)amino]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 54808897 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-[benzyl(methyl)amino]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C16H22N2O/c1-4-11-18(12-5-2)16(19)14-17(3)13-15-9-7-6-8-10-15/h4-10H,1-2,11-14H2,3H3 |
| InChIKey | WDJTUPBWWWLHST-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|